CAS 766545-20-4
:2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
Description:
2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a naphthyridine moiety. This compound features a chlorine atom at the 2-position and a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturated nature. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various applications in pharmaceutical research. The compound may exhibit biological activity, potentially serving as a lead compound in drug development due to its structural properties. Its molecular interactions can be influenced by the presence of the chlorine substituent, which may affect its pharmacokinetic and pharmacodynamic profiles. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride represents a significant compound for further exploration in medicinal chemistry.
Formula:C8H9ClN2.HCL
InChI:InChI=1S/C8H9ClN2.ClH/c9-8-2-1-6-5-10-4-3-7(6)11-8;/h1-2,10H,3-5H2;1H
SMILES:c1cc(Cl)nc2CCNCc12.Cl
Synonyms:- 2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridinehydrochloride
- 1,6-Naphthyridine, 2-Chloro-5,6,7,8-Tetrahydro-, Hydrochloride (1:1)
- 2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
CAS:Formula:C8H10Cl2N2Purity:96%Color and Shape:SolidMolecular weight:205.08442-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
CAS:2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloridePurity:96%Molecular weight:205.08g/mol2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
CAS:Formula:C8H10Cl2N2Purity:97%Molecular weight:205.0842-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
CAS:<p>2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It is also an important reagent for research purposes and a speciality chemical. It has been reported to show high quality and be a useful intermediate for organic reactions. 2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride is also a useful scaffold in the synthesis of novel drugs.</p>Formula:C8H10Cl2N2Purity:Min. 97 Area-%Color and Shape:White Slightly Yellow PowderMolecular weight:205.08 g/mol2-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
CAS:Formula:C8H10Cl2N2Purity:96%Color and Shape:Solid, PowderMolecular weight:205.08




