CAS 766549-26-2

(2-chloro-4-hydroxy-phenyl)boronic acid

Description:

(2-Chloro-4-hydroxy-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a chlorine atom and a hydroxyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications, including organic synthesis and medicinal chemistry. The chlorine substituent can influence the reactivity and selectivity of the compound in chemical reactions. Additionally, the hydroxyl group can participate in hydrogen bonding, enhancing its solubility and reactivity. Overall, (2-chloro-4-hydroxy-phenyl)boronic acid is a versatile compound with significant utility in the development of pharmaceuticals and in the field of materials science.

Formula: C₆H₆BClO₃

InChI: InChI=1/C6H6BClO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9-11H

SMILES: c1cc(c(cc1O)Cl)B(O)O

Synonyms:

• (2-Chloro-4-hydroxyphenyl)boronic acid
• 2-Chloro-4-hydroxyphenylboronic acid
• boronic acid, B-(2-chloro-4-hydroxyphenyl)-

2-Chloro-4-hydroxyphenylboronic acid

CAS: 766549-26-2

Formula: C₆H₆BClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.3740

Ref: IN-DA005AK5

2-Chloro-4-hydroxyphenylboronic acid

CAS: 766549-26-2

2-Chloro-4-hydroxyphenylboronic acid

Formula: C₆H₆BClO₃

Purity: 98%

Color and Shape: white solid

Molecular weight: 172.37g/mol

Ref: 54-OR360269

2-Chloro-4-hydroxyphenylboronic acid

CAS: 766549-26-2

Formula: C₆H₆BClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.37

Ref: 10-F223748