CAS 766557-58-8

N-[4-(tert-butylsulfanyl)pyridin-3-yl]-2,2-dimethylpropanamide

Description:

N-[4-(tert-butylsulfanyl)pyridin-3-yl]-2,2-dimethylpropanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a tert-butylsulfanyl group and an amide functional group. The presence of the tert-butylsulfanyl moiety contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. The amide group indicates that the compound may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its potential biological activity, possibly acting as a ligand or inhibitor in various biochemical pathways. Its molecular structure suggests that it could interact with specific receptors or enzymes, making it a candidate for further pharmacological studies. Additionally, the tert-butyl group provides steric hindrance, which can affect the compound's conformation and interactions with other molecules. Overall, N-[4-(tert-butylsulfanyl)pyridin-3-yl]-2,2-dimethylpropanamide presents a combination of features that may be relevant for applications in drug development and chemical research.

Formula: C₁₄H₂₂N₂OS

InChI: InChI=1/C14H22N2OS/c1-13(2,3)12(17)16-10-9-15-8-7-11(10)18-14(4,5)6/h7-9H,1-6H3,(H,16,17)

SMILES: CC(C)(C)C(=Nc1cnccc1SC(C)(C)C)O

N-(4-tert-Butylsulfanyl-pyridin-3-yl)-2,2-dimethyl-propionamide

CAS: 766557-58-8

Formula: C₁₄H₂₂N₂OS

Molecular weight: 266.4023

Ref: IN-DA005W1Z