CAS 766557-59-9

N-[3-(tert-butylsulfanyl)pyridin-4-yl]-2,2-dimethylpropanamide

Description:

N-[3-(tert-butylsulfanyl)pyridin-4-yl]-2,2-dimethylpropanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a tert-butylsulfanyl group and an amide functional group. The presence of the tert-butylsulfanyl moiety contributes to its lipophilicity, potentially enhancing its ability to interact with biological membranes. The amide group indicates that the compound may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. This compound is likely to be a solid at room temperature, given its structural complexity and the presence of bulky groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyridine ring's role in biological activity. Additionally, the compound may exhibit specific pharmacological properties, making it of interest for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₄H₂₂N₂OS

InChI: InChI=1/C14H22N2OS/c1-13(2,3)12(17)16-10-7-8-15-9-11(10)18-14(4,5)6/h7-9H,1-6H3,(H,15,16,17)

SMILES: CC(C)(C)C(=O)N=c1cc[nH]cc1SC(C)(C)C

N-(3-tert-Butylsulfanyl-pyridin-4-yl)-2,2-dimethyl-propionamide

CAS: 766557-59-9

Formula: C₁₄H₂₂N₂OS

Molecular weight: 266.4023

Ref: IN-DA005J51