CAS 7667-37-0
:1-benzyl-4-(2-chloroethyl)piperazine
Description:
1-Benzyl-4-(2-chloroethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a benzyl group and a chloroethyl substituent contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The chloroethyl group may impart reactivity, making it useful in further chemical modifications. Additionally, the compound's structure suggests it may exhibit certain pharmacological activities, although specific biological effects would depend on the context of its use. Safety data should be consulted, as compounds with halogenated groups can pose health risks, including toxicity and environmental concerns. Proper handling and storage conditions are essential to ensure safety when working with this substance.
Formula:C13H19ClN2
InChI:InChI=1/C13H19ClN2/c14-6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13/h1-5H,6-12H2
SMILES:c1ccc(cc1)CN1CCN(CCCl)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.