CAS 7667-60-9
:(1S,2S,4S)-1,2,4-trimethylcyclohexane
Description:
The chemical substance known as (1S,2S,4S)-1,2,4-trimethylcyclohexane is a cyclic hydrocarbon characterized by its unique stereochemistry and molecular structure. It features a cyclohexane ring with three methyl groups attached at the 1, 2, and 4 positions, contributing to its overall stability and conformation. The stereochemical designation (1S,2S,4S) indicates that the molecule has specific spatial arrangements of its substituents, which can influence its physical and chemical properties, such as boiling point, melting point, and reactivity. This compound is typically colorless and has a characteristic hydrocarbon odor. It is insoluble in water but soluble in organic solvents, making it useful in various applications, including as a solvent or in organic synthesis. The presence of multiple methyl groups can also affect its interactions with other molecules, potentially influencing its behavior in chemical reactions. Overall, (1S,2S,4S)-1,2,4-trimethylcyclohexane is an interesting compound in the study of organic chemistry and stereochemistry.
Formula:C9H18
InChI:InChI=1/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3/t7-,8-,9-/m0/s1
SMILES:C[C@H]1CC[C@H](C)[C@@H](C)C1
Synonyms:- Cyclohexane, 1,2,4-trimethyl-, (1.alpha.,2.beta.,4.beta.)-
- Cyclohexane, 1,2,4-trimethyl-, (1alpha,2beta,4beta)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2R,4R)-rel-1,2,4-Trimethylcyclohexane
CAS:Controlled ProductApplications (1R,2R,4R)-rel-1,2,4-Trimethylcyclohexane is present in jet fuel-derived liquids light fractions.
References Xie, G. et al.: Env. Sci. Tech., 37, 4751 (2003); Gentner, D. et al.: Env. Sci. Tech., 47, 11837 (2013);Formula:C9H18Color and Shape:NeatMolecular weight:126.239
