CymitQuimica logo

CAS 76674-04-9

:

1,1-diphenyl-2-(1H-1,2,4-triazol-1-yl)ethanol

Description:
1,1-Diphenyl-2-(1H-1,2,4-triazol-1-yl)ethanol is an organic compound characterized by its complex structure, which includes a triazole ring and a secondary alcohol functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the triazole moiety suggests potential biological activity, as triazoles are known for their role in antifungal and antimicrobial agents. The diphenyl group enhances the compound's lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's reactivity and interactions with other molecules. Overall, 1,1-diphenyl-2-(1H-1,2,4-triazol-1-yl)ethanol is a versatile compound with potential utility in medicinal chemistry and material science, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C16H15N3O
InChI:InChI=1/C16H15N3O/c20-16(11-19-13-17-12-18-19,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,12-13,20H,11H2
SMILES:c1ccc(cc1)C(Cn1cncn1)(c1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.