CymitQuimica logo

CAS 76674-14-1

:

1,1-bis(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol

Description:
1,1-bis(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol, with the CAS number 76674-14-1, is a chemical compound characterized by its unique structure that includes a triazole ring and fluorinated phenyl groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the triazole moiety suggests possible applications in antifungal or antimicrobial agents, as triazoles are known for their ability to inhibit specific enzymes in pathogens. Additionally, the fluorine atoms in the phenyl groups can enhance the compound's lipophilicity and metabolic stability, which are desirable traits in drug design. The compound's synthesis and characterization often involve standard organic chemistry techniques, and its reactivity may be influenced by the functional groups present. Overall, 1,1-bis(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol represents a class of compounds that bridge organic chemistry and medicinal applications.
Formula:C16H13F2N3O
InChI:InChI=1/C16H13F2N3O/c17-14-5-1-12(2-6-14)16(22,9-21-11-19-10-20-21)13-3-7-15(18)8-4-13/h1-8,10-11,22H,9H2
SMILES:c1cc(ccc1C(Cn1cncn1)(c1ccc(cc1)F)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.