CymitQuimica logo

CAS 76674-22-1

:

1-(2,4-dichlorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol

Description:
1-(2,4-Dichlorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol, with CAS number 76674-22-1, is a chemical compound that belongs to the class of triazole derivatives. It features a complex structure characterized by the presence of a triazole ring, which is known for its biological activity, particularly in antifungal and antimicrobial applications. The compound exhibits significant lipophilicity due to the presence of multiple aromatic rings, which can influence its solubility and permeability in biological systems. The dichlorophenyl and fluorophenyl substituents contribute to its potential reactivity and interaction with biological targets. Additionally, the hydroxyl group (-OH) in the ethanol moiety may enhance its hydrogen bonding capabilities, affecting its pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and toxicity profiles would require further investigation through empirical studies.
Formula:C16H12Cl2FN3O
InChI:InChI=1/C16H12Cl2FN3O/c17-12-3-6-14(15(18)7-12)16(23,8-22-10-20-9-21-22)11-1-4-13(19)5-2-11/h1-7,9-10,23H,8H2
SMILES:c1cc(ccc1C(Cn1cncn1)(c1ccc(cc1Cl)Cl)O)F
Synonyms:
  • 1H-1,2,4-Triazole-1-ethanol, alpha-(2,4-dichlorophenyl)-alpha-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.