CAS 76674-58-3

2-(4-tert-butylphenoxy)-2-methylpropanoic acid

Description:

2-(4-tert-butylphenoxy)-2-methylpropanoic acid, commonly referred to as a herbicide, is characterized by its structural features that include a tert-butyl group and a phenoxy moiety, which contribute to its biological activity. This compound typically appears as a white to off-white solid and is soluble in organic solvents while exhibiting limited solubility in water. Its molecular structure allows it to interact with specific biochemical pathways in plants, making it effective in controlling certain types of weeds. The presence of the carboxylic acid functional group imparts acidic properties, influencing its reactivity and interactions in various environments. Additionally, this compound is known for its relatively low toxicity to mammals, which is a desirable trait in agricultural applications. As with many chemical substances, proper handling and adherence to safety guidelines are essential to mitigate any potential environmental impact or health risks associated with its use.

Formula: C₁₄H₂₀O₃

InChI: InChI=1/C14H20O3/c1-13(2,3)10-6-8-11(9-7-10)17-14(4,5)12(15)16/h6-9H,1-5H3,(H,15,16)

SMILES: CC(C)(C)c1ccc(cc1)OC(C)(C)C(=O)O

Synonyms:

• 2-[4-(Tert-Butyl)Phenoxy]-2-Methylpropanoic Acid
• Propanoic Acid, 2-[4-(1,1-Dimethylethyl)Phenoxy]-2-Methyl-

2-(4-tert-Butylphenoxy)-2-methylpropanoic acid

CAS: 76674-58-3

2-(4-tert-Butylphenoxy)-2-methylpropanoic acid is a versatile building block and reagent for the synthesis of complex compounds. It has been used in research as a possible treatment for inflammatory diseases, including asthma and rheumatoid arthritis. This product is also a useful scaffold for the development of new drugs. 2-(4-tert-Butylphenoxy)-2-methylpropanoic acid has been shown to have antiviral properties against human immunodeficiency virus (HIV) and hepatitis C virus (HCV).

Formula: C₁₄H₂₀O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 236.31 g/mol

Ref: 3D-FB112768

2-(4-tert-Butyl-phenoxy)-2-methyl-propionic acid

CAS: 76674-58-3

Formula: C₁₄H₂₀O₃

Purity: 95.0%

Molecular weight: 236.311

Ref: 10-F059987