CAS 7668-87-3
:N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide
Description:
The chemical substance N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide, commonly referred to by its CAS number 7668-87-3, is a synthetic compound that belongs to the class of acetamides. It features a complex structure characterized by multiple methoxy groups, which contribute to its potential pharmacological properties. The presence of these methoxy substituents enhances the lipophilicity of the molecule, potentially influencing its bioavailability and interaction with biological targets. This compound may exhibit various biological activities, including analgesic or anti-inflammatory effects, although specific studies on its pharmacodynamics and pharmacokinetics may be limited. Its molecular structure suggests that it could interact with neurotransmitter systems, making it of interest in medicinal chemistry. As with many synthetic compounds, safety and toxicity profiles would need to be thoroughly evaluated through rigorous testing before any therapeutic applications. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, particularly in the development of potential therapeutic agents.
Formula:C21H27NO6
InChI:InChI=1/C21H27NO6/c1-24-16-7-6-14(10-17(16)25-2)8-9-22-20(23)13-15-11-18(26-3)21(28-5)19(12-15)27-4/h6-7,10-12H,8-9,13H2,1-5H3,(H,22,23)
SMILES:COc1ccc(CCN=C(Cc2cc(c(c(c2)OC)OC)OC)O)cc1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
