
CAS 7668-88-4
:Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-, hydrochloride (1:1)
Description:
Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-, hydrochloride (1:1) is a complex organic compound characterized by its isoquinoline backbone, which is a bicyclic structure containing a fused benzene and pyridine ring. This specific compound features multiple methoxy groups, which are -OCH3 substituents that enhance its solubility and potentially influence its biological activity. The presence of the hydrochloride indicates that the compound is in its salt form, which typically improves stability and solubility in aqueous solutions. The compound may exhibit various pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, although specific biological activities would need to be investigated through empirical studies. As with many isoquinoline derivatives, it may also possess properties such as antitumor, analgesic, or anti-inflammatory effects, but detailed studies would be necessary to confirm these characteristics.
Formula:C21H27NO5·ClH
InChI:InChI=1S/C21H27NO5.ClH/c1-23-17-11-14-6-7-22-16(15(14)12-18(17)24-2)8-13-9-19(25-3)21(27-5)20(10-13)26-4;/h9-12,16,22H,6-8H2,1-5H3;1H
InChI key:InChIKey=ZRCGZBDFNVWRIO-UHFFFAOYSA-N
SMILES:C(C1C=2C(=CC(OC)=C(OC)C2)CCN1)C3=CC(OC)=C(OC)C(OC)=C3.Cl
Synonyms:- Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-(3,4,5-trimethoxybenzyl)-, hydrochloride
- Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-, hydrochloride (1:1)
- 6,7-Dimethoxy-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline hydrochloride
- Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methyl]-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.