CAS 7669-49-0
:1-(4-Nitrophenyl)-3-phenyl-2-thiourea
Description:
1-(4-Nitrophenyl)-3-phenyl-2-thiourea, with the CAS number 7669-49-0, is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and bonded to two amine groups. This compound features a phenyl group and a para-nitrophenyl substituent, contributing to its aromatic nature and potential reactivity. It typically appears as a solid and is known for its role in various chemical reactions, including those involving nucleophilic substitutions and as a reagent in organic synthesis. The nitro group on the phenyl ring enhances the electrophilicity of the compound, making it useful in applications such as dye synthesis and as an intermediate in pharmaceuticals. Additionally, its thiourea structure can participate in hydrogen bonding and coordination with metal ions, which may influence its solubility and stability in different solvents. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical properties.
Formula:C13H11N3O2S
InChI:InChI=1/C13H11N3O2S/c17-16(18)12-8-6-11(7-9-12)15-13(19)14-10-4-2-1-3-5-10/h1-9H,(H2,14,15,19)
SMILES:c1ccc(cc1)N=C(Nc1ccc(cc1)N(=O)=O)S
Synonyms:- 1-(4-Nitrophenyl)-3-Phenylthiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(4-Nitrophenyl)-3-phenyl-2-thiourea
CAS:1-(4-Nitrophenyl)-3-phenyl-2-thiourea
Molecular weight:273.31034g/mol


