CAS 7669-54-7
:2-Nitrobenzenesulfenyl chloride
Description:
2-Nitrobenzenesulfenyl chloride is an organic compound characterized by the presence of a sulfenyl chloride functional group attached to a nitro-substituted benzene ring. Its molecular structure features a nitro group (-NO2) at the ortho position relative to the sulfenyl chloride group (-SCl), which influences its reactivity and properties. This compound is typically a yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its role as a reagent in organic synthesis, particularly in the formation of sulfenamides and other sulfur-containing compounds. 2-Nitrobenzenesulfenyl chloride is reactive, particularly with nucleophiles, and can undergo hydrolysis in the presence of water, leading to the formation of corresponding sulfenic acids. Safety precautions are essential when handling this compound, as it can be corrosive and may pose health risks if inhaled or in contact with skin. Proper storage in a cool, dry place, away from moisture and incompatible substances, is also crucial to maintain its stability.
Formula:C6H4ClNO2S
InChI:InChI=1S/C6H4ClNO2S/c7-11-6-4-2-1-3-5(6)8(9)10/h1-4H
InChI key:InChIKey=NTNKNFHIAFDCSJ-UHFFFAOYSA-N
SMILES:S(Cl)C1=C(N(=O)=O)C=CC=C1
Synonyms:- (2-Nitrophenyl) thiohypochlorite
- 1-(Chlorosulfanyl)-2-Nitrobenzene
- 2-Nitrobenzenesulfenic acid chloride
- 2-Nitrophenylsulfenyl chloride
- 2-Nitrophenylsulphenyl chloride
- Benzenesulfenyl chloride, 2-nitro-
- Benzenesulfenyl chloride, o-nitro-
- NSC 16179
- o-Nitrobenzenesulfenyl chloride
- o-Nitrobenzenesulphenyl chloride
- o-Nitrophenylsulfenyl chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Nitrophenylsulfenyl Chloride [N-Protecting Agent for Peptides Research]
CAS:Formula:C6H4ClNO2SPurity:>95.0%(GC)(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:189.612-Nitrobenzenesulfenyl chloride, 97%
CAS:<p>2-Nitrobenzenesulfenyl chloride is used as a reagent for N-protection as N-2-nitrophenylsulfenyl (Nps) derivatives, in amino acids and peptides and nucleosides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label info</p>Formula:C6H4ClNO2SPurity:97%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:189.612-Nitrobenzenesulfenyl chloride
CAS:Formula:C6H4ClNO2SPurity:95%Color and Shape:SolidMolecular weight:189.61952-Nitrobenzenesulfenyl chloride
CAS:Formula:C6H4ClNO2SPurity:95%Color and Shape:SolidMolecular weight:189.61



