CAS 76697-51-3

2-(Cyclopentylsulfonyl)benzenamine

Description:

2-(Cyclopentylsulfonyl)benzenamine is an organic compound characterized by the presence of a sulfonyl group attached to a cyclopentyl moiety and an aniline structure. This compound features a benzene ring substituted with an amine group and a cyclopentylsulfonyl group, which contributes to its unique chemical properties. The sulfonyl group enhances the compound's solubility in polar solvents and can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyclopentyl group adds steric bulk, which can affect the compound's interaction with biological targets, potentially leading to applications in medicinal chemistry. Additionally, the presence of the amine group may allow for hydrogen bonding interactions, further influencing its physical and chemical behavior. Overall, 2-(Cyclopentylsulfonyl)benzenamine is a compound of interest in research and development, particularly in the fields of pharmaceuticals and materials science, due to its distinctive structural features and potential functional applications.

Formula: C₁₁H₁₅NO₂S

InChI: InChI=1S/C11H15NO2S/c12-10-7-3-4-8-11(10)15(13,14)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6,12H2

InChI key: InChIKey=NDFGZXFQVSEJDM-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(N)C=CC=C1)C2CCCC2

Synonyms:

• 2-(Cyclopentylsulfonyl)benzenamine
• Benzenamine, 2-(cyclopentylsulfonyl)-
• 2-Aminophenyl cyclopentyl sulfone
• 2-(Cyclopentanesulfonyl)aniline
• 2-Cyclopentylsulfonylaniline

2-Cyclopentylsulfonylaniline

Controlled Product

CAS: 76697-51-3

Applications 2-cyclopentylsulfonylaniline (cas# 76697-51-3) is a useful research chemical.

Formula: C₁₁H₁₅NO₂S

Color and Shape: Neat

Molecular weight: 225.31

Ref: TR-B424170