CAS 76697-55-7

Benzenamine, 2-(butylsulfonyl)-, hydrochloride (1:1)

Description:

Benzenamine, 2-(butylsulfonyl)-, hydrochloride (1:1), with the CAS number 76697-55-7, is an organic compound characterized by the presence of a benzenamine moiety substituted with a butylsulfonyl group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the hydrochloride salt form, which enhances its solubility in water. The butylsulfonyl group contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it exhibits properties such as increased stability and improved handling characteristics compared to its free base form. The compound may also display biological activity, making it of interest for research in medicinal chemistry. Safety data should be consulted to understand its toxicity and handling precautions, as with any chemical substance. Overall, benzenamine derivatives are known for their diverse applications, and this specific compound may serve as a building block in synthetic organic chemistry.

Formula: C₁₀H₁₅NO₂S·ClH

InChI: InChI=1S/C10H15NO2S.ClH/c1-2-3-8-14(12,13)10-7-5-4-6-9(10)11;/h4-7H,2-3,8,11H2,1H3;1H

InChI key: InChIKey=MRKPWUOGOFDTJM-UHFFFAOYSA-N

SMILES: S(CCCC)(=O)(=O)C1=C(N)C=CC=C1.Cl

Synonyms:

• Benzenamine, 2-(butylsulfonyl)-, hydrochloride (1:1)
• Benzenamine, 2-(butylsulfonyl)-, hydrochloride
• 2-Aminophenyl butyl sulfone hydrochloride