CAS 76699-46-2
:bromo-(3-fluoro-4-phenyl-phenyl)magnesium
Description:
Bromo-(3-fluoro-4-phenyl-phenyl)magnesium, with the CAS number 76699-46-2, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. The specific structure of this compound includes a bromo substituent and a fluorophenyl group, which can influence its reactivity and the types of reactions it can participate in. Grignard reagents are typically used in nucleophilic addition reactions, allowing for the formation of carbon-carbon bonds, and can react with various electrophiles, including carbonyl compounds. The presence of both bromine and fluorine in the structure may impart unique electronic properties, affecting its reactivity and stability. As with many organometallic compounds, care must be taken when handling this substance, as it can react violently with water and other protic solvents, releasing flammable hydrocarbons. Proper safety protocols should be followed to mitigate risks associated with its use.
Formula:C12H8BrFMg
InChI:InChI=1/C12H8F.BrH.Mg/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;/h1-4,6-9H;1H;/q;;+1/p-1/rC12H8BrFMg/c13-15-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h1-8H
SMILES:c1ccc(cc1)C1=CC=C=CC1F.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-[1,1-biphenyl]-4-magnesiumbromide 0.5M solution in THF
CAS:2-Fluoro-[1,1-biphenyl]-4-magnesiumbromide 0.5M solution in THF
Molecular weight:275.40g/mol
