CAS 767-13-5

(1s,3R,5S)-3,5-dimethylcyclohexanol

Description:

(1s,3R,5S)-3,5-dimethylcyclohexanol is a cyclic alcohol characterized by a cyclohexane ring with two methyl groups attached at the 3 and 5 positions, along with a hydroxyl (-OH) group at the 1 position. This compound exhibits chirality due to the presence of multiple stereocenters, specifically at the 3 and 5 positions, leading to distinct enantiomers. The presence of the hydroxyl group imparts polar characteristics, making it soluble in polar solvents while maintaining some hydrophobic properties due to the hydrocarbon ring and methyl groups. Its molecular structure contributes to its potential applications in organic synthesis and as a building block in the production of various chemical compounds. The compound's physical properties, such as boiling point and melting point, are influenced by its molecular weight and the arrangement of its substituents. Additionally, (1s,3R,5S)-3,5-dimethylcyclohexanol can participate in various chemical reactions typical of alcohols, including dehydration and oxidation, making it a versatile compound in organic chemistry.

Formula: C₈H₁₆O

InChI: InChI=1/C8H16O/c1-6-3-7(2)5-8(9)4-6/h6-9H,3-5H2,1-2H3/t6-,7+,8-

Synonyms:

• (1.alpha.,3.alpha.,5.alpha.)-3,5-Dimethyl-cyclohexanol
• (1alpha,3alpha,5alpha)-3,5-Dimethylcyclohexanol
• Cyclohexanol, 3,5-Dimethyl-, (1Alpha,3Alpha,5Alpha)-
• (1s,3R,5S)-3,5-Dimethylcyclohexanol

3,5-dimethylcyclohexan-1-ol

CAS: 767-13-5

Formula: C₈H₁₆O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 128.2120

Ref: IN-DA00GPXV

(1s,3R,5S)-rel-3,5-Dimethylcyclohexan-1-ol

CAS: 767-13-5

(1s,3R,5S)-rel-3,5-Dimethylcyclohexan-1-ol

Purity: 97%

Molecular weight: 128.21g/mol

Ref: 54-OR1070051

cis,cis-3,5-Dimethylcyclohexanol

Controlled Product

CAS: 767-13-5

Formula: C₈H₁₆O

Color and Shape: Neat

Molecular weight: 128.212

Ref: TR-D465030