CAS 767-87-3
:1-ethynyl-2,3-dimethylbenzene
Description:
1-Ethynyl-2,3-dimethylbenzene, also known as 1-ethynyl-2,3-xylene, is an aromatic compound characterized by a benzene ring substituted with an ethynyl group and two methyl groups at the 2 and 3 positions. Its molecular formula is C11H10, indicating it contains 11 carbon atoms and 10 hydrogen atoms. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is known for its relatively high stability due to the resonance of the aromatic ring, but it can participate in various chemical reactions, including electrophilic substitutions and polymerization. The presence of the ethynyl group introduces a triple bond, which can be reactive under certain conditions, making it useful in organic synthesis and materials science. Additionally, 1-ethynyl-2,3-dimethylbenzene is often utilized in the production of polymers and as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health hazards if inhaled or ingested.
Formula:C10H10
InChI:InChI=1/C10H10/c1-4-10-7-5-6-8(2)9(10)3/h1,5-7H,2-3H3
SMILES:C#Cc1cccc(C)c1C
Synonyms:- Benzene, 1-ethynyl-2,3-dimethyl-
- Benzene, 1-ethynyl-2,3-dimethyl- (9CI)
- 1-ETHYNYL-2,3-DIMETHYL-BENZENE
- 2,3-DiMethylphenylacetylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Ethynyl-2,3-dimethylbenzene
CAS:1-Ethynyl-2,3-dimethylbenzene is a mesoporous material with a large surface area. It has the ability to adsorb large amounts of nitrogen gas and can be used as an adsorbent for the removal of nitrogen from natural gas. The cyclophane is composed of an aromatic ring and a heterocyclic ring, which are connected by a single bond. This compound has been shown to have high emission profiles in the visible region. It also has hysteresis properties due to its microporous nature. 1-Ethynyl-2,3-dimethylbenzene is a polymer that is conjugated, giving it high stacking abilities with other materials.
Formula:C10H10Purity:Min. 95%Molecular weight:130.19 g/mol
