CAS 767-89-5
:6-Fluoro-N<sup>4</sup>-methyl-4,5-pyrimidinediamine
Description:
6-Fluoro-N^4-methyl-4,5-pyrimidinediamine, with the CAS number 767-89-5, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 4 and 5 positions. The presence of a fluorine atom at the 6 position contributes to its unique reactivity and potential applications in medicinal chemistry. The N^4-methyl group enhances its solubility and may influence its biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly in the development of antiviral or anticancer agents, due to its ability to interact with biological targets. Its properties include being a solid at room temperature, with moderate stability under standard conditions. The compound's synthesis typically involves multi-step organic reactions, and it is important to handle it with care, following appropriate safety protocols, as with many nitrogen-containing heterocycles. Overall, 6-Fluoro-N^4-methyl-4,5-pyrimidinediamine represents a significant interest in the field of organic and medicinal chemistry.
Formula:C5H7FN4
InChI:InChI=1S/C5H7FN4/c1-8-5-3(7)4(6)9-2-10-5/h2H,7H2,1H3,(H,8,9,10)
InChI key:InChIKey=FJTMODFMGVQNPZ-UHFFFAOYSA-N
SMILES:N(C)C=1C(N)=C(F)N=CN1
Synonyms:- 6-Fluoro-N4-methyl-4,5-pyrimidinediamine
- Pyrimidine, 5-amino-4-fluoro-6-(methylamino)-
- 4,5-Pyrimidinediamine, 6-fluoro-N4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.