CAS 767-92-0
:rel-(4aR,8aS)-Decahydroquinoline
Description:
Rel-(4aR,8aS)-Decahydroquinoline is a bicyclic organic compound characterized by its unique structure, which consists of a saturated nitrogen-containing ring system. This compound features a quinoline framework, specifically in a decahydro form, indicating that it is fully saturated with hydrogen atoms. The stereochemistry is defined by the rel-(4aR,8aS) configuration, which denotes specific spatial arrangements of the atoms in the molecule, influencing its chemical behavior and interactions. Decahydroquinoline is typically colorless to pale yellow and may exhibit a mild odor. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic nature. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as boiling point, melting point, and reactivity, can vary based on the specific conditions and the presence of functional groups in related compounds.
Formula:C9H17N
InChI:InChI=1/C9H17N/c1-2-6-9-8(4-1)5-3-7-10-9/h8-10H,1-7H2/t8-,9+/s2
InChI key:InChIKey=POTIYWUALSJREP-BRJQIKQINA-N
SMILES:[C@]12([C@](CCCC1)(NCCC2)[H])[H]
Synonyms:- Quinoline, decahydro-, (4aR,8aS)-rel-
- Quinoline, decahydro-, trans-
- rel-(4aR,8aS)-Decahydroquinoline
- trans-Decahydroquinoline
- trans-Decahydroquinoline
- (4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline
- trans-quinolin
- -Decahydroquinoline
- trans
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans-Decahydroquinoline
CAS:Formula:C9H17NPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:139.24trans-Decahydroquinoline
CAS:Trans-decahydroquinoline is a chiral compound that can be synthesized by an asymmetric synthesis. It is an amide with a carbonyl group and a dialkylamino group. Trans-decahydroquinoline can be used to synthesize different compounds, such as enantiopure drugs, pharmaceuticals, and agrochemicals. The synthesis of trans-decahydroquinoline can be accomplished through the aldol cyclization or the addition of an acid to the carbonyl group. The magnetic resonance spectroscopy (NMR) and molecular modeling techniques have been used to study its structure and properties.
Formula:C9H17NPurity:Min. 95%Molecular weight:139.24 g/molRef: 3D-FD76040
Discontinued product





