
CAS 767-93-1
:2H-Pyrano[2,3-c]pyridine
Description:
2H-Pyrano[2,3-c]pyridine, with the CAS number 767-93-1, is a heterocyclic organic compound characterized by a fused pyridine and pyran ring system. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties, which contribute to its stability and reactivity. It has a molecular formula that reflects its complex structure, incorporating both nitrogen and oxygen atoms within its rings. The compound is often studied for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, due to the presence of reactive sites in its structure. Additionally, 2H-Pyrano[2,3-c]pyridine can serve as a building block in the synthesis of more complex organic molecules, highlighting its utility in organic synthesis and pharmaceutical development.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c1-2-7-3-4-9-6-8(7)10-5-1/h1-4,6H,5H2
InChI key:InChIKey=BVIHAADUZBOGSJ-UHFFFAOYSA-N
SMILES:C=12C(=CN=CC1)OCC=C2
Synonyms:- 2H-Pyrano[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.