
CAS 76701-33-2
:Butene, 2-methyl-, homopolymer
Description:
Butene, 2-methyl-, homopolymer, commonly referred to as poly(2-methylbutene), is a synthetic polymer derived from the polymerization of 2-methyl-1-butene. This polymer exhibits several notable characteristics, including a low density and a relatively low melting point compared to other polymers. It is known for its excellent clarity, flexibility, and resistance to UV light, making it suitable for various applications, including packaging materials and automotive components. The polymer is also characterized by its high thermal stability and chemical resistance, which allows it to maintain its properties under a range of environmental conditions. Additionally, poly(2-methylbutene) has good electrical insulating properties, making it useful in electrical applications. Its processing can be achieved through conventional methods such as extrusion and injection molding. Overall, the unique combination of properties makes 2-methylbutene homopolymer a versatile material in both industrial and consumer products.
Formula:(C5H10)x
InChI:InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3
InChI key:InChIKey=QWTDNUCVQCZILF-UHFFFAOYSA-N
SMILES:C(CC)(C)C
Synonyms:- Polyisopentene
- Poly(methylbutene)
- Butene, 2-methyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
