CAS 76706-59-7

6-amino-N-hydroxypyridine-3-carboxamide

Description:

6-Amino-N-hydroxypyridine-3-carboxamide, with the CAS number 76706-59-7, is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group, a hydroxyl group, and a carboxamide functional group. This compound typically exhibits properties associated with both amines and carboxamides, such as potential hydrogen bonding capabilities due to the presence of the hydroxyl and amine groups. It is likely to be soluble in polar solvents, given the presence of these functional groups, which can engage in dipole-dipole interactions and hydrogen bonding. The compound may also exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Its structural features suggest it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the presence of the hydroxyl group may enhance its reactivity and solubility, making it a candidate for further chemical modifications or applications in medicinal chemistry and material science.

Formula: C₆H₇N₃O₂

InChI: InChI=1/C6H7N3O2/c7-5-2-1-4(3-8-5)6(10)9-11/h1-3,11H,(H2,7,8)(H,9,10)

SMILES: c1cc(=N)[nH]cc1C(=NO)O

6-Amino-N-hydroxypyridine-3-carboxamide

CAS: 76706-59-7

6-Amino-N-hydroxypyridine-3-carboxamide is a toxic substance that can cause poisoning in humans and animals. It has been used as an anticoagulant in rodenticides, but it is not effective against rodents with resistance to this type of poison. Symptoms of 6-Amino-N-hydroxypyridine-3-carboxamide poisoning include vomiting, dizziness, drowsiness, headache, and coma. The toxic effects are due to the inhibition of vitamin K epoxide reductase (VKOR). Antidotes for 6-Amino-N-hydroxypyridine-3-carboxamide poisoning include nicotinamide and vitamin K1.

Formula: C₆H₇N₃O₂

Purity: Min. 95%

Molecular weight: 153.14 g/mol

Ref: 3D-BDA70659