
CAS 7672-76-6
:α1,α4-Dimethyl-1,4-piperazinediethanol
Description:
α1,α4-Dimethyl-1,4-piperazinediethanol, with the CAS number 7672-76-6, is a chemical compound characterized by its piperazine structure, which includes two methyl groups and two hydroxyl (alcohol) functional groups. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of hydroxyl groups contributes to its potential as a ligand in coordination chemistry and as a building block in organic synthesis. Additionally, the piperazine ring structure imparts certain biological activities, which may be relevant in pharmaceutical contexts. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, α1,α4-Dimethyl-1,4-piperazinediethanol is notable for its unique structural features and potential applications in both industrial and research settings.
Formula:C10H22N2O2
InChI:InChI=1S/C10H22N2O2/c1-9(13)7-11-3-5-12(6-4-11)8-10(2)14/h9-10,13-14H,3-8H2,1-2H3
InChI key:InChIKey=ZRMOLCPODIMNPJ-UHFFFAOYSA-N
SMILES:C(C(C)O)N1CCN(CC(C)O)CC1
Synonyms:- N,N′-Bis(2-hydroxypropyl)piperazine
- 1,4-Piperazinediethanol, α1,α4-dimethyl-
- α1,α4-Dimethyl-1,4-piperazinediethanol
- 1,4-Bis(2-hydroxypropyl)piperazine
- 1,4-Piperazinediethanol, α,α′-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.