CymitQuimica logo

CAS 767240-85-7

:

3-morpholinobutanoic acid

Description:
3-Morpholinobutanoic acid is an organic compound characterized by its morpholine ring and a butanoic acid functional group. It features a morpholine moiety, which is a six-membered heterocyclic structure containing one nitrogen atom, contributing to its unique chemical properties. This compound typically exhibits both hydrophilic and lipophilic characteristics due to the presence of the carboxylic acid group and the morpholine ring, making it soluble in polar solvents. It is often studied for its potential applications in pharmaceuticals and biochemistry, particularly as a building block in the synthesis of various bioactive molecules. The presence of the morpholine group can influence the compound's biological activity, potentially enhancing its interaction with biological targets. Additionally, 3-morpholinobutanoic acid may participate in various chemical reactions, including esterification and amidation, due to its functional groups. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C8H15NO3
InChI:InChI=1/C8H15NO3/c1-7(6-8(10)11)9-2-4-12-5-3-9/h7H,2-6H2,1H3,(H,10,11)
SMILES:CC(CC(=O)O)N1CCOCC1
Synonyms:
  • 3-(Morpholin-4-Yl)Butanoic Acid
  • 4-Morpholinepropanoic Acid, Β-Methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.