CAS 76727-28-1

3,4-Dihydro-2H-chromen-3-ylmethanol

Description:

3,4-Dihydro-2H-chromen-3-ylmethanol, identified by the CAS number 76727-28-1, is a chemical compound characterized by its chromene structure, which consists of a benzopyran ring system. This compound features a hydroxymethyl group (-CH2OH) at the 3-position of the chromene, contributing to its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxymethyl group enhances its solubility in polar solvents, making it useful in various chemical reactions and applications. 3,4-Dihydro-2H-chromen-3-ylmethanol may exhibit interesting pharmacological properties, including antioxidant and anti-inflammatory activities, which are common in compounds derived from natural sources. Its structural features allow for potential modifications that could lead to the development of new derivatives with enhanced biological activities. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₂O₂

InChI: InChI=1/C10H12O2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-4,8,11H,5-7H2

SMILES: c1ccc2c(c1)CC(CO)CO2

(3,4-Dihydro-2H-1-benzopyran-3-yl)methanol

CAS: 76727-28-1

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₂

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-BDA72728