CAS 767282-21-3
:Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one
Description:
Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both a furo[3,4-b]pyridine moiety and a piperidine ring. This compound typically exhibits a fused bicyclic system, contributing to its potential biological activity and chemical stability. The presence of the furo and pyridine rings suggests that it may engage in various interactions, such as hydrogen bonding and π-π stacking, which can influence its reactivity and solubility. Additionally, the piperidinone component may impart basic properties, allowing for interactions with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial, anti-inflammatory, or anticancer activities. The specific characteristics, such as melting point, solubility, and spectral properties, would depend on the compound's purity and the conditions under which it is studied. Overall, Spiro[furo[3,4-b]pyridine-5(7H),4'-piperidin]-7-one represents a fascinating area of research in the field of organic and medicinal chemistry.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c14-10-9-8(2-1-5-13-9)11(15-10)3-6-12-7-4-11/h1-2,5,12H,3-4,6-7H2
SMILES:c1cc2c(C(=O)OC32CCNCC3)nc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
