CAS 767287-99-0
:methyl (5S,8S,11S,14S)-8-(3-amino-3-oxopropyl)-14-(fluoroacetyl)-5-(2-methoxy-2-oxoethyl)-11-[2-(methylsulfanyl)ethyl]-3,6,9,12-tetraoxo-1-phenyl-2-oxa-4,7,10,13-tetraazahexadecan-16-oate (non-preferred name)
Description:
The chemical substance with the name "methyl (5S,8S,11S,14S)-8-(3-amino-3-oxopropyl)-14-(fluoroacetyl)-5-(2-methoxy-2-oxoethyl)-11-[2-(methylsulfanyl)ethyl]-3,6,9,12-tetraoxo-1-phenyl-2-oxa-4,7,10,13-tetraazahexadecan-16-oate" and CAS number "767287-99-0" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetraazahexadecan backbone, indicating the presence of four nitrogen atoms within a 16-carbon chain, which contributes to its potential biological activity. The presence of multiple keto groups (indicated by "tetraoxo") suggests reactivity and potential for forming various derivatives. Additionally, the molecule contains a methoxy group and a methylsulfanyl group, which can influence its solubility and interaction with biological systems. The fluoroacetyl moiety may enhance its pharmacological properties, possibly affecting its binding affinity to biological targets. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C29H40FN5O11S
InChI:InChI=1/C29H40FN5O11S/c1-44-24(38)13-20(22(36)15-30)34-27(41)19(11-12-47-3)33-26(40)18(9-10-23(31)37)32-28(42)21(14-25(39)45-2)35-29(43)46-16-17-7-5-4-6-8-17/h4-8,18-21H,9-16H2,1-3H3,(H2,31,37)(H,32,42)(H,33,40)(H,34,41)(H,35,43)/t18-,19-,20-,21-/m0/s1
SMILES:COC(=O)C[C@@H](C(=O)CF)N=C([C@H](CCSC)N=C([C@H](CCC(=N)O)N=C([C@H](CC(=O)OC)N=C(O)OCc1ccccc1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-DQMD-FMK
CAS:Caspase-3 inhibitor. Inhibits MG 132-induced small cell lung cancer cell death in vitro.
Formula:C29H40FN5O11SPurity:98%Color and Shape:SolidMolecular weight:685.72Z-Asp(OMe)-Gln-Met-DL-Asp(OMe)-fluoromethylketone
CAS:Z-Asp(OMe)-Gln-Met-DL-Asp(OMe)-fluoromethylketone is a mitochondria-targeting compound that has been shown to have neuroprotective and anti-inflammatory properties. It binds to the ATP synthase in the mitochondrial membrane, inhibiting ATP production and causing cell death by apoptosis. ZAFMK also inhibits kinases such as protein kinase 3β (PK3β) and caspase 9, which are involved in inflammation and apoptosis. ZAFMK has been shown to be effective against various diseases such as multiple sclerosis, Alzheimer's disease, Parkinson's disease, amyotrophic lateral sclerosis, Huntington's disease, and stroke.
Formula:C29H40FN5O11SPurity:Min. 95%Molecular weight:685.72 g/mol

