
CAS 76732-75-7
:Picartamide
Description:
Picartamide, with the CAS number 76732-75-7, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which typically include an amide functional group (-C(=O)N-) that is derived from the reaction of a carboxylic acid and an amine. Picartamide is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit specific solubility properties, stability under certain conditions, and reactivity with other chemical species, which are essential for its functionality in synthetic processes or biological interactions. Additionally, like many amides, it may have a relatively high melting point and moderate volatility. Safety and handling considerations are important, as with any chemical substance, and proper precautions should be taken to mitigate any potential hazards associated with its use. Further research and characterization studies are often necessary to fully understand its properties and applications.
Formula:C11H14N2S2
InChI:InChI=1S/C11H14N2S2/c1-12-10(14)11(6-4-8-15-11)9-5-2-3-7-13-9/h2-3,5,7H,4,6,8H2,1H3,(H,12,14)
InChI key:InChIKey=ITNLONMDUMHEOK-UHFFFAOYSA-N
SMILES:C(NC)(=S)C1(CCCS1)C2=CC=CC=N2
Synonyms:- Picartamide
- 2-Thiophenecarbothioamide, tetrahydro-N-methyl-2-(2-pyridinyl)-
- RP 40749
- Tetrahydro-N-methyl-2-(2-pyridinyl)-2-thiophenecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.