CAS 76734-92-4

bis(trimethylsilyl) but-2-ynedioate

Description:

Bis(trimethylsilyl) but-2-ynedioate is an organosilicon compound characterized by the presence of two trimethylsilyl groups attached to a but-2-ynedioate moiety. This compound features a conjugated system with a triple bond and two carbonyl groups, contributing to its reactivity and potential applications in organic synthesis. The trimethylsilyl groups enhance the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, including nucleophilic additions and as a protecting group in synthetic pathways. Its structure allows for the formation of various derivatives, which can be exploited in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the silyl groups can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. Overall, bis(trimethylsilyl) but-2-ynedioate is a versatile compound in synthetic organic chemistry, valued for its unique structural features and functional properties.

Formula: C₁₀H₁₈O₄Si₂

InChI: InChI=1/C10H18O4Si2/c1-15(2,3)13-9(11)7-8-10(12)14-16(4,5)6/h1-6H3

SMILES: C[Si](C)(C)OC(=O)C#CC(=O)O[Si](C)(C)C

Synonyms:

• 2-Butynedioic Acid, Bis(Trimethylsilyl) Ester
• Bis(trimethylsilyl) but-2-ynedioate