CAS 76735-58-5
:Cannflavin B
Description:
Cannflavin B is a flavonoid compound primarily found in cannabis plants, particularly in the Cannabis sativa species. It belongs to a class of compounds known as flavones, which are characterized by their polyphenolic structure. Cannflavin B is notable for its potential anti-inflammatory and analgesic properties, which have garnered interest in both medicinal and therapeutic contexts. This compound is believed to work by inhibiting the production of certain inflammatory mediators, making it a subject of research for its potential applications in pain management and inflammation-related conditions. Cannflavin B is also recognized for its role in the plant's defense mechanisms against pests and pathogens. Its unique chemical structure, which includes a prenylated flavonoid backbone, contributes to its biological activity and potential health benefits. As research continues, Cannflavin B may offer insights into novel therapeutic agents derived from natural sources, particularly in the realm of cannabinoid research and phytochemistry.
Formula:C21H20O6
InChI:InChI=1S/C21H20O6/c1-11(2)4-6-13-15(23)9-19-20(21(13)25)16(24)10-17(27-19)12-5-7-14(22)18(8-12)26-3/h4-5,7-10,22-23,25H,6H2,1-3H3
InChI key:InChIKey=IXCUTZUASDSIJO-UHFFFAOYSA-N
SMILES:OC1=C2C(OC(=CC2=O)C3=CC(OC)=C(O)C=C3)=CC(O)=C1CC=C(C)C
Synonyms:- Canniflavone 1
- 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-
- Cannflavin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cannflavin B
CAS:Cannflavin B, a prenylated flavone derived from Cannabis sativa L., exhibits anti-inflammatory activity [1].Formula:C21H20O6Color and Shape:SolidMolecular weight:368.38Cannflavin B
CAS:Controlled ProductApplications Cannflavin B is a prenylated flavone which can be isolated from the cannabinoid free ethanolic extract of Cannabis sativa L.
References Barrett, M. L., Experientia, 42, 452-3, (1986)Formula:C21H22O6Color and Shape:NeatMolecular weight:370.3958Cannflavin B
CAS:Cannflavin B is a specialized flavonoid compound, which is a secondary metabolite derived from Cannabis sativa. It exhibits a distinct mode of action as a potent anti-inflammatory agent. Cannflavin B exerts its effects through the inhibition of pro-inflammatory mediators such as prostaglandins and leukotrienes. These biochemical pathways are typically linked with the cyclooxygenase (COX) and lipoxygenase (LOX) enzymes, and Cannflavin B effectively interferes with these enzymatic processes to reduce inflammation at the molecular level.
Formula:C21H20O6Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:368.38 g/molRef: 3D-XC176307
Discontinued product



