CAS 76735-58-5

Cannflavin B

Description:

Cannflavin B is a flavonoid compound primarily found in cannabis plants, particularly in the Cannabis sativa species. It belongs to a class of compounds known as flavones, which are characterized by their polyphenolic structure. Cannflavin B is notable for its potential anti-inflammatory and analgesic properties, which have garnered interest in both medicinal and therapeutic contexts. This compound is believed to work by inhibiting the production of certain inflammatory mediators, making it a subject of research for its potential applications in pain management and inflammation-related conditions. Cannflavin B is also recognized for its role in the plant's defense mechanisms against pests and pathogens. Its unique chemical structure, which includes a prenylated flavonoid backbone, contributes to its biological activity and potential health benefits. As research continues, Cannflavin B may offer insights into novel therapeutic agents derived from natural sources, particularly in the realm of cannabinoid research and phytochemistry.

Formula: C₂₁H₂₀O₆

InChI: InChI=1S/C21H20O6/c1-11(2)4-6-13-15(23)9-19-20(21(13)25)16(24)10-17(27-19)12-5-7-14(22)18(8-12)26-3/h4-5,7-10,22-23,25H,6H2,1-3H3

InChI key: InChIKey=IXCUTZUASDSIJO-UHFFFAOYSA-N

SMILES: OC1=C2C(OC(=CC2=O)C3=CC(OC)=C(O)C=C3)=CC(O)=C1CC=C(C)C

Synonyms:

• Canniflavone 1
• 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-
• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-
• Cannflavin B

Cannflavin B

CAS: 76735-58-5

Formula: C₂₁H₂₀O₆

Color and Shape: Yellow Solid

Molecular weight: 368.39

Ref: 4Z-C-291003

Cannflavin B

Controlled Product

CAS: 76735-58-5

Applications Cannflavin B is a prenylated flavone which can be isolated from the cannabinoid free ethanolic extract of Cannabis sativa L.
References Barrett, M. L., Experientia, 42, 452-3, (1986)

Formula: C₂₁H₂₂O₆

Color and Shape: Neat

Molecular weight: 370.3958

Ref: TR-C175405

Cannflavin B

CAS: 76735-58-5

Cannflavin B is a specialized flavonoid compound, which is a secondary metabolite derived from Cannabis sativa. It exhibits a distinct mode of action as a potent anti-inflammatory agent. Cannflavin B exerts its effects through the inhibition of pro-inflammatory mediators such as prostaglandins and leukotrienes. These biochemical pathways are typically linked with the cyclooxygenase (COX) and lipoxygenase (LOX) enzymes, and Cannflavin B effectively interferes with these enzymatic processes to reduce inflammation at the molecular level.

Formula: C₂₁H₂₀O₆

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 368.38 g/mol

Ref: 3D-XC176307