CAS 767352-29-4
:(R)-3-(Benzyloxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid
Description:
(R)-3-(Benzyloxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a butanoic acid backbone, which is a four-carbon chain terminating in a carboxylic acid group, contributing to its acidic properties. The presence of a benzyloxyamino group indicates that it contains both an amine and an ether functional group, which can influence its reactivity and solubility. The trifluorophenyl substituent introduces significant electronegative fluorine atoms, enhancing the compound's lipophilicity and potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its stereochemistry, denoted by the (R) configuration, is crucial for its interaction with biological targets, as chirality can significantly influence the efficacy and safety of pharmaceutical agents. Overall, this compound's unique combination of functional groups and stereochemistry makes it a subject of interest in various chemical and biological studies.
Formula:C17H16F3NO3
InChI:InChI=1/C17H16F3NO3/c18-14-9-16(20)15(19)7-12(14)6-13(8-17(22)23)21-24-10-11-4-2-1-3-5-11/h1-5,7,9,13,21H,6,8,10H2,(H,22,23)/t13-/m1/s1
Synonyms:- Cbz-(r)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid
- Sitagliptin-Benzyloxy butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-3-((Benzyloxy)amino)-4-(2,4,5-trifluorophenyl)butanoic acid
CAS:Formula:C17H16F3NO3Molecular weight:339.3090
