CAS 76741-88-3
:cleomycin B2
Description:
Cleomycin B2 is an antibiotic compound that belongs to the class of glycopeptide antibiotics, which are known for their efficacy against a variety of Gram-positive bacteria. It is produced by the fermentation of certain strains of the bacterium *Streptomyces* and is structurally related to other antibiotics in the cleomycin family. Cleomycin B2 exhibits antibacterial activity by inhibiting bacterial protein synthesis, primarily through binding to the 50S ribosomal subunit. This action disrupts the translation process, ultimately leading to cell death. The compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Cleomycin B2 is often studied for its potential therapeutic applications, particularly in treating infections caused by resistant bacterial strains. However, like many antibiotics, it may also have side effects and resistance issues associated with its use. Its CAS number, 76741-88-3, is a unique identifier that facilitates the cataloging and study of this specific chemical substance in scientific literature and databases.
Formula:C56H84N20O21S2
InChI:InChI=1/C56H84N20O21S2/c1-19-33(73-46(76-44(19)59)24(11-31(58)80)68-12-23(57)45(60)86)50(90)75-35(41(25-13-64-18-69-25)95-54-43(39(84)37(82)29(14-77)94-54)96-53-40(85)42(97-56(63)92)38(83)30(15-78)93-53)51(91)70-21(3)36(81)20(2)47(87)74-34(22-10-28(22)79)49(89)66-9-6-32-71-27(17-98-32)52-72-26(16-99-52)48(88)65-7-4-5-8-67-55(61)62/h13,16-18,20-24,28-30,34-43,53-54,68,77-79,81-85H,4-12,14-15,57H2,1-3H3,(H2,58,80)(H2,60,86)(H2,63,92)(H,64,69)(H,65,88)(H,66,89)(H,70,91)(H,74,87)(H,75,90)(H2,59,73,76)(H4,61,62,67)
Synonyms:- (16S)-N1-[4-[[Amino(imino)methyl]amino]butyl]-16-de(1-hydroxyethyl)-16-(1-hydroxycyclopropyl)bleomycinamide
- cleomycin B2
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
