CymitQuimica logo

CAS 76746-19-5

:

2-amino-5-fluoro-benzohydrazide

Description:
2-Amino-5-fluoro-benzohydrazide is an organic compound characterized by the presence of an amino group and a hydrazide functional group attached to a benzene ring that also contains a fluorine atom. Its molecular structure features a benzene ring substituted at the 5-position with a fluorine atom and at the 2-position with an amino group, which contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is often used in pharmaceutical research and as an intermediate in organic synthesis, particularly in the development of biologically active compounds. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of derivatives, making it of interest in medicinal chemistry. As with many hydrazides, it may also exhibit biological activity, including potential antimicrobial or antitumor properties, warranting further investigation in drug development contexts.
Formula:C7H8FN3O
InChI:InChI=1/C7H8FN3O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,9-10H2,(H,11,12)
SMILES:c1cc(c(cc1F)C(=NN)O)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.