CAS 76746-94-6
:7-methoxyisoquinoline-1,3(2H,4H)-dione
Description:
7-Methoxyisoquinoline-1,3(2H,4H)-dione, with the CAS number 76746-94-6, is a chemical compound characterized by its isoquinoline structure, which features a methoxy group at the 7-position and a dione functional group. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. As a derivative of isoquinoline, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The dione functionality suggests potential reactivity, allowing for further chemical modifications. Its molecular structure contributes to its stability and reactivity, which can be explored in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, 7-methoxyisoquinoline-1,3(2H,4H)-dione is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-14-7-3-2-6-4-9(12)11-10(13)8(6)5-7/h2-3,5H,4H2,1H3,(H,11,12,13)
SMILES:COc1ccc2CC(=NC(=O)c2c1)O
Synonyms:- 1,3(2H,4H)-isoquinolinedione, 7-methoxy-
- 7-Methoxyisoquinoline-1,3(2H,4H)-dione
- 7-Methoxy-1,2,3,4-tetrahydroisoquinoline-1,3-dione
- 7-methoxy-4H-isoquinoline-1,3-dione
- 7-Methoxy-1,3(2H,4H)-isoquinolinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
