CymitQuimica logo

CAS 76757-90-9

:

boc-D-tyrosine methyl ester

Description:
Boc-D-tyrosine methyl ester is a derivative of the amino acid tyrosine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and a methyl ester functional group. This compound is typically used in peptide synthesis and organic chemistry due to its ability to protect the amino group of tyrosine, allowing for selective reactions at other functional groups. The Boc group is stable under basic conditions but can be removed under acidic conditions, making it a useful protecting group in multi-step synthesis. The methyl ester enhances the lipophilicity of the molecule, which can facilitate its incorporation into various biological systems. Additionally, Boc-D-tyrosine methyl ester is often utilized in the development of pharmaceuticals and biologically active compounds, as it can serve as a building block for more complex structures. Its molecular structure includes a phenolic hydroxyl group, which contributes to its reactivity and potential interactions in biological systems. Overall, Boc-D-tyrosine methyl ester is a valuable compound in synthetic organic chemistry and medicinal chemistry.
Formula:C15H21NO5
InChI:InChI=1/C15H21NO5/c1-15(2,3)21-14(19)16-12(13(18)20-4)9-10-5-7-11(17)8-6-10/h5-8,12,17H,9H2,1-4H3,(H,16,19)/t12-/m1/s1
InChI key:NQIFXJSLCUJHBB-GFCCVEGCSA-N
SMILES:CC(C)(C)OC(=N[C@H](Cc1ccc(cc1)O)C(=O)OC)O
Synonyms:
  • N-T-boc-D-tyrosine methyl ester
  • Boc-D-Tyr-OMe
  • methyl N-(tert-butoxycarbonyl)-D-tyrosinate
Found 4 products.