CAS 76765-61-2
:3-amino-4-methyl-N-propylbenzamide
Description:
3-Amino-4-methyl-N-propylbenzamide, identified by its CAS number 76765-61-2, is an organic compound characterized by the presence of an amine group, a methyl group, and a propyl group attached to a benzamide structure. This compound features a benzene ring substituted with an amino group at the meta position (3-position) and a methyl group at the para position (4-position) relative to the amine. The N-propyl group is attached to the carbonyl carbon of the amide functional group. This structure contributes to its potential biological activity and solubility properties. The presence of both hydrophilic (amine and amide) and hydrophobic (benzene and propyl) components suggests that it may exhibit interesting interactions in biological systems. Additionally, the compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities would require further investigation. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-3-6-13-11(14)9-5-4-8(2)10(12)7-9/h4-5,7H,3,6,12H2,1-2H3,(H,13,14)
SMILES:CCCN=C(c1ccc(C)c(c1)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.