CymitQuimica logo

CAS 76765-62-3

:

3-amino-4-methyl-N-(propan-2-yl)benzamide

Description:
3-Amino-4-methyl-N-(propan-2-yl)benzamide, identified by its CAS number 76765-62-3, is an organic compound characterized by its aromatic amide structure. It features an amine group (-NH2) and a methyl group (-CH3) on the benzene ring, along with an isopropyl group (-C3H7) attached to the nitrogen atom of the amide functional group. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amine and amide functionalities, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the presence of functional groups that can interact with biological targets. The compound may exhibit various biological activities, but specific properties such as melting point, boiling point, and reactivity would depend on the conditions and environment in which it is studied. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-7(2)13-11(14)9-5-4-8(3)10(12)6-9/h4-7H,12H2,1-3H3,(H,13,14)
SMILES:CC(C)N=C(c1ccc(C)c(c1)N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.