
CAS 76778-14-8
:4,5-Difluoro-2-iodobenzeneacetic acid
Description:
4,5-Difluoro-2-iodobenzeneacetic acid is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzene ring, along with a carboxylic acid functional group. This compound features a benzene ring with two fluorine atoms located at the 4 and 5 positions and an iodine atom at the 2 position, which influences its reactivity and physical properties. The carboxylic acid group contributes to its acidity and solubility in polar solvents. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogen atoms, which can also affect their boiling and melting points. The presence of these halogens can enhance the compound's reactivity in nucleophilic substitution reactions and may also influence its biological activity, making it of interest in medicinal chemistry. Additionally, the unique combination of substituents may impart specific characteristics that could be useful in various applications, including pharmaceuticals and agrochemicals. Safety and handling precautions should be observed due to the potential hazards associated with halogenated compounds.
Formula:C8H5F2IO2
InChI:InChI=1S/C8H5F2IO2/c9-5-1-4(2-8(12)13)7(11)3-6(5)10/h1,3H,2H2,(H,12,13)
InChI key:InChIKey=NCPSGQVIDNPOIY-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(I)C=C(F)C(F)=C1
Synonyms:- Benzeneacetic acid, 4,5-difluoro-2-iodo-
- 4,5-Difluoro-2-iodobenzeneacetic acid
- 2-(4,5-Difluoro-2-iodophenyl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.