CAS 76779-67-4

1,2:5,6-di-O-cyclohexylidene-D-mannitol

Description:

1,2:5,6-Di-O-cyclohexylidene-D-mannitol is a chemical compound characterized by its unique structure, which includes two cyclohexylidene groups attached to the mannitol backbone. This compound is a derivative of mannitol, a sugar alcohol commonly used in pharmaceuticals and food products. The cyclohexylidene groups enhance the lipophilicity of the molecule, potentially affecting its solubility and bioavailability. It is typically a white to off-white solid at room temperature and may exhibit stability under standard conditions. The compound is of interest in various fields, including medicinal chemistry and carbohydrate chemistry, due to its potential applications in drug formulation and delivery systems. Its specific reactivity and interactions can be influenced by the presence of the cyclohexylidene groups, which may participate in various chemical reactions or interactions with biological targets. As with many organic compounds, proper handling and safety precautions should be observed, as the compound may have specific toxicity or reactivity profiles.

Formula: C₁₈H₃₀O₆

InChI: InChI=1/C18H30O6/c19-15(13-11-21-17(23-13)7-3-1-4-8-17)16(20)14-12-22-18(24-14)9-5-2-6-10-18/h13-16,19-20H,1-12H2/t13-,14?,15-,16-/m1/s1

SMILES: C1CCC2(CC1)OC[C@H]([C@H]([C@@H](C1COC3(CCCCC3)O1)O)O)O2

D-Mannitol, 1,2:5,6-di-O-cyclohexylidene-

CAS: 76779-67-4

Formula: C₁₈H₃₀O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 342.4272

Ref: IN-DA00G5EF

(1S,2S)-1,2-Di((R)-1,4-Dioxaspiro[4.5]Decan-2-yl)Ethane-1,2-Diol

CAS: 76779-67-4

(1S,2S)-1,2-Di((R)-1,4-Dioxaspiro[4.5]Decan-2-yl)Ethane-1,2-Diol

Purity: 97%

Molecular weight: 342.43g/mol

Ref: 54-OR1007911

(1S,2S)-1,2-di((R)-1,4-Dioxaspiro[4.5]decan-2-yl)ethane-1,2-diol

CAS: 76779-67-4

Purity: 97%(GC-MS);RG

Molecular weight: 342.4320068

Ref: 10-F620518

1,2:5,6-Di-O-cyclohexylidene-D-mannitol

CAS: 76779-67-4

1,2:5,6-Di-O-cyclohexylidene-D-mannitol is a ligand that binds to metal ions. It forms a complex with nitro groups, which has been shown to have synergistic effects in transfer reactions. The structure of 1,2:5,6-Di-O-cyclohexylidene-D-mannitol was determined by x-ray diffraction and the crystal structure was confirmed by single crystal x-ray diffraction. This ligand can be used for the synthesis of alkenes and it reacts with magnesium chloride to form a grignard reagent. As a ligand, this compound has anticancer activity and can be used as an antiangiogenic agent.

Formula: C₁₈H₃₀O₆

Purity: Min. 95%

Molecular weight: 342.43 g/mol

Ref: 3D-MD03954