CAS 76780-98-8

5H-Cyclopentapyrimidin-4-amine, 2-chloro-6,7-dihydro-N-methyl-

Description:

5H-Cyclopentapyrimidin-4-amine, 2-chloro-6,7-dihydro-N-methyl- is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrimidine and cyclopentane moieties. The presence of a chlorine atom at the 2-position and a methyl group attached to the nitrogen at the 6,7-dihydro position contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties typical of nitrogen-containing heterocycles, such as being a potential ligand in coordination chemistry or a precursor in pharmaceutical synthesis. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and stability in various solvents. The compound's CAS number, 76780-98-8, allows for precise identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and materials science. Overall, the characteristics of this compound make it a subject of interest for further investigation in various chemical and biological contexts.

Formula: C₈H₁₀ClN₃

InChI: InChI=1S/C8H10ClN3/c1-10-7-5-3-2-4-6(5)11-8(9)12-7/h2-4H2,1H3,(H,10,11,12)

InChI key: InChIKey=QUHPTBBMGYVJPK-UHFFFAOYSA-N

SMILES: N(C)C1=C2C(=NC(Cl)=N1)CCC2

Synonyms:

• 2-Chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
• 2-Chloro-N-methyl-5H,6H,7H-cyclopenta[d]pyrimidin-4-amine
• 5H-Cyclopentapyrimidin-4-amine, 2-chloro-6,7-dihydro-N-methyl-

2-Chloro-n-methyl-6,7-dihydro-5h-cyclopenta[d]pyrimidin-4-amine

CAS: 76780-98-8

Formula: C₈H₁₀ClN₃

Molecular weight: 183.6381

Ref: IN-DA005UOI

2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine

CAS: 76780-98-8

Formula: C₈H₁₀ClN₃

Purity: 95.0%

Molecular weight: 183.64

Ref: 10-F311218