CymitQuimica logo

CAS 76782-82-6

:

tert-butyl(dimethyl)(prop-2-yn-1-yloxy)silane

Description:
Tert-butyl(dimethyl)(prop-2-yn-1-yloxy)silane is an organosilicon compound characterized by the presence of a silicon atom bonded to a tert-butyl group, two methyl groups, and a prop-2-yn-1-yloxy group. This compound typically exhibits properties common to silanes, such as low volatility and reactivity, particularly in the presence of moisture, which can lead to hydrolysis and the formation of silanol groups. The tert-butyl group contributes to steric hindrance, influencing the compound's reactivity and solubility in organic solvents. The presence of the alkyne functional group (prop-2-yn-1-yloxy) suggests potential for further chemical reactivity, particularly in coupling reactions or as a precursor in organic synthesis. Additionally, the dimethyl groups enhance the hydrophobic character of the molecule, making it suitable for applications in organic synthesis, surface modification, or as a coupling agent in various chemical processes. Overall, this compound's unique structure imparts specific chemical behaviors that can be exploited in various industrial and research applications.
Formula:C9H18OSi
InChI:InChI=1/C9H18OSi/c1-7-8-10-11(5,6)9(2,3)4/h1H,8H2,2-6H3
InChI key:ZYDKYFIXEYSNPO-UHFFFAOYSA-N
SMILES:C#CCO[Si](C)(C)C(C)(C)C
Synonyms:
  • Silane, (1,1-Dimethylethyl)Dimethyl(2-Propyn-1-Yloxy)-
  • Tert-Butyldimethyl(Prop-2-Ynyloxy)Silane
Found 6 products.