CAS 76783-59-0
:Benzoic acid, 3-(trifluoromethyl)-, ethyl ester
Description:
Benzoic acid, 3-(trifluoromethyl)-, ethyl ester, also known by its CAS number 76783-59-0, is an organic compound characterized by the presence of a benzoic acid moiety with a trifluoromethyl group at the meta position and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic characteristics. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. Benzoic acid derivatives are often utilized in various applications, including as preservatives, flavoring agents, and intermediates in organic synthesis. The presence of the trifluoromethyl group may impart unique properties, such as increased stability and altered electronic characteristics, making it of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C10H9F3O2
InChI:InChI=1S/C10H9F3O2/c1-2-15-9(14)7-4-3-5-8(6-7)10(11,12)13/h3-6H,2H2,1H3
InChI key:InChIKey=MHNBTKIAHHECCQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- Benzoic acid, 3-(trifluoromethyl)-, ethyl ester
- Ethyl 3-(trifluoromethyl)benzoate
- Ethyl m-(trifluoromethyl)benzoate
- 3-(Trifluoromethyl)benzoic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3-(trifluoromethyl)benzoate
CAS:Formula:C10H9F3O2Purity:97%Color and Shape:LiquidMolecular weight:218.1725Ethyl 3-(trifluoromethyl)benzoate
CAS:Ethyl 3-(trifluoromethyl)benzoateFormula:C10H9F3O2Purity:97%Color and Shape: colourless liquidMolecular weight:218.17g/molEthyl 3-(trifluoromethyl)benzoate
CAS:Formula:C10H9F3O2Purity:97%Color and Shape:LiquidMolecular weight:218.175Ethyl 3-(trifluoromethyl)benzoate
CAS:Ethyl 3-(trifluoromethyl)benzoate is an organic compound that belongs to the class of graphs. It has a chemical formula of C9H7F3O2 and molecular weight of 179.1 g/mol. The graph contains 4 atoms, with one atom in the center, 2 atoms on each side, and 1 atom at each end. The graph has a connectivity index of 0.5, meaning that it has no bonds between the atoms. This graph was calculated using the theory of atomic orbitals, which states that there are 8 electrons in this graph and they are placed around its nucleus in 4 different orbits or shells. There is a total of 6 atomic orbitals: sigma (σ), pi (π), lambda (λ), xi (ξ), eta (η) and omega (ω). These atomic orbitals have been weighted by their corresponding electron density to calculate the total electron density for this molecule. The weightingFormula:C10H9F3O2Purity:Min. 95%Molecular weight:218.17 g/mol



