CymitQuimica logo

CAS 76787-83-2

:

1-(Cyclopropylmethyl)piperidine

Description:
1-(Cyclopropylmethyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a cyclopropylmethyl group attached to the nitrogen atom of the piperidine ring contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many piperidine derivatives. Its structure allows for flexibility in molecular conformation, which can influence its biological activity and interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-(Cyclopropylmethyl)piperidine is of interest in both academic and industrial research settings.
Formula:C9H17N
InChI:InChI=1S/C9H17N/c1-2-6-10(7-3-1)8-9-4-5-9/h9H,1-8H2
InChI key:InChIKey=FGRIVGLVHHUSHB-UHFFFAOYSA-N
SMILES:C(N1CCCCC1)C2CC2
Synonyms:
  • Piperidine, 1-(cyclopropylmethyl)-
  • 1-(Cyclopropylmethyl)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.