CAS 768-16-1

5-Nitro-2-norbornene

Description:

5-Nitro-2-norbornene is an organic compound characterized by its bicyclic structure, which features a nitro group (-NO2) attached to the norbornene framework. This compound is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic substitutions and cycloadditions. The presence of the nitro group enhances its electrophilic character, making it a useful intermediate in the synthesis of more complex molecules. 5-Nitro-2-norbornene is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its unique structure contributes to its potential applications in materials science and pharmaceuticals. However, like many nitro compounds, it may pose environmental and health risks, necessitating careful handling and storage. Overall, 5-Nitro-2-norbornene is a valuable compound in the field of organic chemistry, with diverse applications stemming from its distinctive properties.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c9-8(10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2

SMILES: C1=CC2CC1CC2N(=O)=O

Synonyms:

• 5-Nitrobicyclo[2.2.1]hept-2-ene

5-Nitrobicyclo[2.2.1]hept-2-ene

CAS: 768-16-1

Versatile small molecule scaffold

Formula: C₇H₉NO₂

Purity: Min. 95%

Molecular weight: 139.15 g/mol

Ref: 3D-AAA76816