
CAS 768-36-5
:2-Pyrazinecarboxamide, 4-oxide
Description:
2-Pyrazinecarboxamide, 4-oxide, also known by its CAS number 768-36-5, is a heterocyclic organic compound characterized by a pyrazine ring with a carboxamide functional group and an oxide substituent. This compound typically exhibits a pale yellow to white crystalline appearance and is soluble in polar solvents such as water and alcohols. Its molecular structure includes a nitrogen-containing aromatic ring, which contributes to its potential biological activity and reactivity. The presence of the carboxamide group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. 2-Pyrazinecarboxamide, 4-oxide may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development and as a building block in synthetic chemistry. Additionally, its stability under standard conditions makes it a suitable candidate for further research into its properties and applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H5N3O2
InChI:InChI=1S/C5H5N3O2/c6-5(9)4-3-8(10)2-1-7-4/h1-3H,(H2,6,9)
InChI key:InChIKey=WWQPCELPPKZBJE-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=N(=O)C=CN1
Synonyms:- Pyrazinamide, 4-oxide
- Pyrazinecarboxamide, 4-oxide
- 2-Pyrazinecarboxamide, 4-oxide
- NSC 140938
- 3-Carbamoylpyrazine 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.