CAS 768-56-9
:4-Phenyl-1-butene
Description:
4-Phenyl-1-butene is an organic compound classified as an alkene, characterized by the presence of a double bond between carbon atoms. Its molecular formula is C10H12, indicating it consists of ten carbon atoms and twelve hydrogen atoms. This compound features a phenyl group (a benzene ring) attached to the butene chain, specifically at the fourth carbon position, which influences its chemical reactivity and physical properties. 4-Phenyl-1-butene is typically a colorless to pale yellow liquid with a characteristic odor. It is insoluble in water but soluble in organic solvents, making it useful in various chemical applications. The compound can undergo typical alkene reactions, such as hydrogenation, polymerization, and electrophilic addition, due to the presence of the double bond. Additionally, it may exhibit isomerism, leading to different structural forms. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 4-Phenyl-1-butene is significant in organic synthesis and the production of various chemical intermediates.
Formula:C10H12
InChI:InChI=1S/C10H12/c1-2-3-7-10-8-5-4-6-9-10/h2,4-6,8-9H,1,3,7H2
InChI key:InChIKey=PBGVMIDTGGTBFS-UHFFFAOYSA-N
SMILES:C(CC=C)C1=CC=CC=C1
Synonyms:- 1-Butene, 4-phenyl-
- 1-Phenyl-3-butene
- 3-Buten-1-ylbenzene
- 3-Butenylbenzene
- 4-Phenylbutene
- Benzene, 3-buten-1-yl-
- Benzene, 3-butenyl-
- But-3-En-1-Ylbenzene
- Homoallylbenzene
- NSC 65603
- Phenylbutene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Phenyl-1-butene
CAS:Formula:C10H12Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:132.214-Phenyl-1-butene
CAS:Formula:C10H12Purity:98.0%Color and Shape:Liquid, Clear colourless to almost colourless liquidMolecular weight:132.2064-Phenyl-1-butene
CAS:<p>4-Phenyl-1-butene is an aryl halide that undergoes acylation reactions with the addition of hydrochloric acid. The reaction is efficient and produces high yields. 4-Phenyl-1-butene can be used in the synthesis of fosinopril sodium, which is a drug used to treat high blood pressure. The reaction requires hydrogen chloride gas, which reacts with the butene to produce chloride ions as well as sequences containing 4 phenyl groups. 4-Phenyl-1-butene is also used for asymmetric synthesis and copolymerization reactions. Copolymerization reactions are done at low temperatures to avoid polymerization and crosslinking of monomers.</p>Formula:C10H12Purity:Min. 95%Molecular weight:132.21 g/mol



