CAS 768-91-2
:1-Methyladamantane
Description:
1-Methyladamantane, with the CAS number 768-91-2, is a derivative of adamantane, a polycyclic hydrocarbon known for its unique cage-like structure. This compound features a methyl group attached to one of the carbon atoms in the adamantane framework, which contributes to its distinct chemical properties. It is a colorless, crystalline solid at room temperature and exhibits a high melting point due to its rigid structure. 1-Methyladamantane is relatively hydrophobic, making it soluble in organic solvents but insoluble in water. The compound is known for its stability and resistance to oxidation, which is characteristic of many adamantane derivatives. Its unique structure allows for potential applications in various fields, including pharmaceuticals and materials science, where it may serve as a building block for more complex molecules or as a component in drug formulations. Additionally, its properties can be influenced by the presence of functional groups or substituents, making it a subject of interest in organic synthesis and chemical research.
Formula:C11H18
InChI:InChI=1S/C11H18/c1-11-5-8-2-9(6-11)4-10(3-8)7-11/h8-10H,2-7H2,1H3
InChI key:InChIKey=UZUCFTVAWGRMTQ-UHFFFAOYSA-N
SMILES:CC12CC3CC(C1)CC(C2)C3
Synonyms:- 1-Methyladamantane
- 1-Methyltricyclo[3.3.1.1<sup>3,7</sup>]decane
- Adamantane, 1-methyl-
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane, 1-methyl-
- Tricyclo[3.3.1.1~3,7~]Decane, 1-Methyl-
- 1-Methyltricyclo[3.3.1.13,7]decane
- Tricyclo[3.3.1.13,7]decane, 1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Methyladamantane
CAS:Formula:C11H18Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:150.271-Methyl adamantane
CAS:1-Methyl adamantane is a molecule that is used in the chemical industry. It can be synthesized from 1,3-butadiene, which is obtained from petroleum or coal tar. The molecule has been shown to have anti-inflammatory properties and can be used for the treatment of autoimmune diseases, such as multiple sclerosis and rheumatoid arthritis. This compound has also shown potential as a therapeutic agent for inflammatory diseases like Crohn's disease and ulcerative colitis. The mechanism of action of 1-methyl adamantane may be due to its ability to inhibit the production of inflammatory cytokines such as tumor necrosis factor alpha (TNFα), interleukin-1 beta (IL-1β), and IL-6. This inhibition occurs when 1-methyl adamantane binds to the enzyme cyclooxygenase (COX).Formula:C11H18Purity:Min. 95%Color and Shape:White PowderMolecular weight:150.26 g/mol







