CAS 76809-63-7
:N-(4-benzoylphenyl)-2-iodoacetamide
Description:
N-(4-benzoylphenyl)-2-iodoacetamide, with the CAS number 76809-63-7, is an organic compound characterized by its structure, which includes a benzoyl group and an iodoacetamide moiety. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the iodine atom. The benzoyl group contributes to its stability and may influence its electronic properties, making it useful in various chemical reactions, including those involving nucleophilic substitution. Additionally, the iodoacetamide functional group can participate in biological interactions, potentially serving as a reagent in biochemical applications. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, N-(4-benzoylphenyl)-2-iodoacetamide is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science.
Formula:C15H12INO2
InChI:InChI=1/C15H12INO2/c16-10-14(18)17-13-8-6-12(7-9-13)15(19)11-4-2-1-3-5-11/h1-9H,10H2,(H,17,18)
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)NC(=O)CI
Synonyms:- Acetamide, N-(4-benzoylphenyl)-2-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
